![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
.JPG){kind=link}
![[ ]](/icons/odf6odt-20x22.png){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Lecture 1 Audio.m4a | 2018-09-12 22:20 | 25M | |
| IMG_0196.JPG | 2018-09-12 22:20 | 1.5M | |
| IMG_0196(1).JPG | 2018-09-12 22:20 | 1.5M | |
| Lecture 1 Transcript.odt | 2018-09-12 22:20 | 41K | |
| preparing for lectures scan/ | 2018-09-12 22:20 | - | |
| how to use visual aids (unit 8)/ | 2018-09-12 22:20 | - | |
| The structure of lectures (unit 3)/ | 2018-09-12 22:20 | - | |
| Strategies for notetaking (unit 7)/ | 2018-09-12 22:20 | - | |
| Lecture The history of universities in Western Europe/ | 2018-09-12 22:20 | - | |
| Lecture Bill Gates/ | 2018-09-12 22:20 | - | |